C10H10N4O2 — CID 105063971
3-methoxy-N-(1H-pyrazol-4-yl)pyridine-4-carboxamide (PubChem CID 105063971) has the molecular formula C10H10N4O2 and a molecular weight of 218.22 g/mol. Its IUPAC name is 3-methoxy-N-(1H-pyrazol-4-yl)pyridine-4-carboxamide.
| Compound Name | 3-methoxy-N-(1H-pyrazol-4-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 105063971 |
| Molecular Formula | C10H10N4O2 |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | 3-methoxy-N-(1H-pyrazol-4-yl)pyridine-4-carboxamide |
| SMILES | COc1cnccc1C(=O)Nc1cn[nH]c1 |
| InChI | InChI=1S/C10H10N4O2/c1-16-9-6-11-3-2-8(9)10(15)14-7-4-12-13-5-7/h2-6H,1H3,(H,12,13)(H,14,15) |
| InChIKey | WOHPSXDXWLHULQ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |