C19H32BrN3O3 — CID 60569752
1-(2-bromo-4,5-dimethoxyphenyl)-3-[2-(diethylamino)-4-methylpentyl]urea (PubChem CID 60569752) has the molecular formula C19H32BrN3O3 and a molecular weight of 430.39 g/mol. Its IUPAC name is 1-(2-bromo-4,5-dimethoxyphenyl)-3-[2-(diethylamino)-4-methylpentyl]urea.
| Compound Name | 1-(2-bromo-4,5-dimethoxyphenyl)-3-[2-(diethylamino)-4-methylpentyl]urea |
|---|---|
| PubChem CID | 60569752 |
| Molecular Formula | C19H32BrN3O3 |
| Molecular Weight | 430.39 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | 1-(2-bromo-4,5-dimethoxyphenyl)-3-[2-(diethylamino)-4-methylpentyl]urea |
| SMILES | CCN(CC)C(CNC(=O)Nc1cc(OC)c(OC)cc1Br)CC(C)C |
| InChI | InChI=1S/C19H32BrN3O3/c1-7-23(8-2)14(9-13(3)4)12-21-19(24)22-16-11-18(26-6)17(25-5)10-15(16)20/h10-11,13-14H,7-9,12H2,1-6H3,(H2,21,22,24) |
| InChIKey | OJDKAGIXXKAVJS-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.39 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |