C20H35N3O4 — CID 51944228
1-[(2S)-2-(diethylamino)-4-methylpentyl]-3-(3,4,5-trimethoxyphenyl)urea (PubChem CID 51944228) has the molecular formula C20H35N3O4 and a molecular weight of 381.52 g/mol. Its IUPAC name is 1-[(2S)-2-(diethylamino)-4-methylpentyl]-3-(3,4,5-trimethoxyphenyl)urea.
| Compound Name | 1-[(2S)-2-(diethylamino)-4-methylpentyl]-3-(3,4,5-trimethoxyphenyl)urea |
|---|---|
| PubChem CID | 51944228 |
| Molecular Formula | C20H35N3O4 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.26 |
| IUPAC Name | 1-[(2S)-2-(diethylamino)-4-methylpentyl]-3-(3,4,5-trimethoxyphenyl)urea |
| SMILES | CCN(CC)[C@H](CNC(=O)Nc1cc(OC)c(OC)c(OC)c1)CC(C)C |
| InChI | InChI=1S/C20H35N3O4/c1-8-23(9-2)16(10-14(3)4)13-21-20(24)22-15-11-17(25-5)19(27-7)18(12-15)26-6/h11-12,14,16H,8-10,13H2,1-7H3,(H2,21,22,24)/t16-/m0/s1 |
| InChIKey | ZHDCPLPFGKFIMU-INIZCTEOSA-N |
| XLogP | 3.59 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |