C17H28BrN3O — CID 52590736
1-(2-bromophenyl)-3-[(2S)-2-(diethylamino)-4-methylpentyl]urea (PubChem CID 52590736) has the molecular formula C17H28BrN3O and a molecular weight of 370.34 g/mol. Its IUPAC name is 1-(2-bromophenyl)-3-[(2S)-2-(diethylamino)-4-methylpentyl]urea.
| Compound Name | 1-(2-bromophenyl)-3-[(2S)-2-(diethylamino)-4-methylpentyl]urea |
|---|---|
| PubChem CID | 52590736 |
| Molecular Formula | C17H28BrN3O |
| Molecular Weight | 370.34 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 1-(2-bromophenyl)-3-[(2S)-2-(diethylamino)-4-methylpentyl]urea |
| SMILES | CCN(CC)[C@H](CNC(=O)Nc1ccccc1Br)CC(C)C |
| InChI | InChI=1S/C17H28BrN3O/c1-5-21(6-2)14(11-13(3)4)12-19-17(22)20-16-10-8-7-9-15(16)18/h7-10,13-14H,5-6,11-12H2,1-4H3,(H2,19,20,22)/t14-/m0/s1 |
| InChIKey | NXDFTCHCPLYDBL-AWEZNQCLSA-N |
| XLogP | 4.33 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.34 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |