C19H33N3O2 — CID 60545361
1-[2-(diethylamino)-4-methylpentyl]-3-(2-methoxy-4-methylphenyl)urea (PubChem CID 60545361) has the molecular formula C19H33N3O2 and a molecular weight of 335.49 g/mol. Its IUPAC name is 1-[2-(diethylamino)-4-methylpentyl]-3-(2-methoxy-4-methylphenyl)urea.
| Compound Name | 1-[2-(diethylamino)-4-methylpentyl]-3-(2-methoxy-4-methylphenyl)urea |
|---|---|
| PubChem CID | 60545361 |
| Molecular Formula | C19H33N3O2 |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.26 |
| IUPAC Name | 1-[2-(diethylamino)-4-methylpentyl]-3-(2-methoxy-4-methylphenyl)urea |
| SMILES | CCN(CC)C(CNC(=O)Nc1ccc(C)cc1OC)CC(C)C |
| InChI | InChI=1S/C19H33N3O2/c1-7-22(8-2)16(11-14(3)4)13-20-19(23)21-17-10-9-15(5)12-18(17)24-6/h9-10,12,14,16H,7-8,11,13H2,1-6H3,(H2,20,21,23) |
| InChIKey | OPMBKXHVRBBMNQ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |