C16H27N3O — CID 51943970
1-[(2S)-2-(diethylamino)propyl]-3-(2,5-dimethylphenyl)urea (PubChem CID 51943970) has the molecular formula C16H27N3O and a molecular weight of 277.41 g/mol. Its IUPAC name is 1-[(2S)-2-(diethylamino)propyl]-3-(2,5-dimethylphenyl)urea.
| Compound Name | 1-[(2S)-2-(diethylamino)propyl]-3-(2,5-dimethylphenyl)urea |
|---|---|
| PubChem CID | 51943970 |
| Molecular Formula | C16H27N3O |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.22 |
| IUPAC Name | 1-[(2S)-2-(diethylamino)propyl]-3-(2,5-dimethylphenyl)urea |
| SMILES | CCN(CC)[C@@H](C)CNC(=O)Nc1cc(C)ccc1C |
| InChI | InChI=1S/C16H27N3O/c1-6-19(7-2)14(5)11-17-16(20)18-15-10-12(3)8-9-13(15)4/h8-10,14H,6-7,11H2,1-5H3,(H2,17,18,20)/t14-/m0/s1 |
| InChIKey | OAQLDJMRADQHAO-AWEZNQCLSA-N |
| XLogP | 3.16 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |