C11H17BrN2O2 — CID 103523756
N'-(3-bromo-2,4-dimethoxyphenyl)propane-1,3-diamine (PubChem CID 103523756) has the molecular formula C11H17BrN2O2 and a molecular weight of 289.17 g/mol. Its IUPAC name is N'-(3-bromo-2,4-dimethoxyphenyl)propane-1,3-diamine.
| Compound Name | N'-(3-bromo-2,4-dimethoxyphenyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 103523756 |
| Molecular Formula | C11H17BrN2O2 |
| Molecular Weight | 289.17 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | N'-(3-bromo-2,4-dimethoxyphenyl)propane-1,3-diamine |
| SMILES | COc1ccc(NCCCN)c(OC)c1Br |
| InChI | InChI=1S/C11H17BrN2O2/c1-15-9-5-4-8(14-7-3-6-13)11(16-2)10(9)12/h4-5,14H,3,6-7,13H2,1-2H3 |
| InChIKey | KUTBRBDVCBKNFJ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.17 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|