C13H22N2O2S — CID 64682841
4-amino-N-[(2-ethylphenyl)methyl]butane-1-sulfonamide (PubChem CID 64682841) has the molecular formula C13H22N2O2S and a molecular weight of 270.40 g/mol. Its IUPAC name is 4-amino-N-[(2-ethylphenyl)methyl]butane-1-sulfonamide.
| Compound Name | 4-amino-N-[(2-ethylphenyl)methyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 64682841 |
| Molecular Formula | C13H22N2O2S |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 4-amino-N-[(2-ethylphenyl)methyl]butane-1-sulfonamide |
| SMILES | CCc1ccccc1CNS(=O)(=O)CCCCN |
| InChI | InChI=1S/C13H22N2O2S/c1-2-12-7-3-4-8-13(12)11-15-18(16,17)10-6-5-9-14/h3-4,7-8,15H,2,5-6,9-11,14H2,1H3 |
| InChIKey | NJLKSAQXPCGSQU-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|