C11H17BrN2O2S — CID 106018731
4-amino-N-[(3-bromophenyl)methyl]butane-1-sulfonamide (PubChem CID 106018731) has the molecular formula C11H17BrN2O2S and a molecular weight of 321.24 g/mol. Its IUPAC name is 4-amino-N-[(3-bromophenyl)methyl]butane-1-sulfonamide.
| Compound Name | 4-amino-N-[(3-bromophenyl)methyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 106018731 |
| Molecular Formula | C11H17BrN2O2S |
| Molecular Weight | 321.24 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | 4-amino-N-[(3-bromophenyl)methyl]butane-1-sulfonamide |
| SMILES | NCCCCS(=O)(=O)NCc1cccc(Br)c1 |
| InChI | InChI=1S/C11H17BrN2O2S/c12-11-5-3-4-10(8-11)9-14-17(15,16)7-2-1-6-13/h3-5,8,14H,1-2,6-7,9,13H2 |
| InChIKey | MYTVFPFUTQUYQB-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.24 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|