C11H15ClFNO2S — CID 116815181
4-chloro-N-[(3-fluorophenyl)methyl]butane-1-sulfonamide (PubChem CID 116815181) has the molecular formula C11H15ClFNO2S and a molecular weight of 279.76 g/mol. Its IUPAC name is 4-chloro-N-[(3-fluorophenyl)methyl]butane-1-sulfonamide.
| Compound Name | 4-chloro-N-[(3-fluorophenyl)methyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 116815181 |
| Molecular Formula | C11H15ClFNO2S |
| Molecular Weight | 279.76 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | 4-chloro-N-[(3-fluorophenyl)methyl]butane-1-sulfonamide |
| SMILES | O=S(=O)(CCCCCl)NCc1cccc(F)c1 |
| InChI | InChI=1S/C11H15ClFNO2S/c12-6-1-2-7-17(15,16)14-9-10-4-3-5-11(13)8-10/h3-5,8,14H,1-2,6-7,9H2 |
| InChIKey | ZANXSYGNFJBPOG-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.76 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|