C11H16N2O6S2 — CID 43361776
3-[[3-(dimethylsulfamoyl)phenyl]sulfamoyl]propanoic acid (PubChem CID 43361776) has the molecular formula C11H16N2O6S2 and a molecular weight of 336.39 g/mol. Its IUPAC name is 3-[[3-(dimethylsulfamoyl)phenyl]sulfamoyl]propanoic acid.
| Compound Name | 3-[[3-(dimethylsulfamoyl)phenyl]sulfamoyl]propanoic acid |
|---|---|
| PubChem CID | 43361776 |
| Molecular Formula | C11H16N2O6S2 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | 3-[[3-(dimethylsulfamoyl)phenyl]sulfamoyl]propanoic acid |
| SMILES | CN(C)S(=O)(=O)c1cccc(NS(=O)(=O)CCC(=O)O)c1 |
| InChI | InChI=1S/C11H16N2O6S2/c1-13(2)21(18,19)10-5-3-4-9(8-10)12-20(16,17)7-6-11(14)15/h3-5,8,12H,6-7H2,1-2H3,(H,14,15) |
| InChIKey | GIILOUMOAKLDRX-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |