C13H17FN2 — CID 65248851
4-(4-fluoro-2-methylanilino)-2,2-dimethylbutanenitrile (PubChem CID 65248851) has the molecular formula C13H17FN2 and a molecular weight of 220.29 g/mol. Its IUPAC name is 4-(4-fluoro-2-methylanilino)-2,2-dimethylbutanenitrile.
| Compound Name | 4-(4-fluoro-2-methylanilino)-2,2-dimethylbutanenitrile |
|---|---|
| PubChem CID | 65248851 |
| Molecular Formula | C13H17FN2 |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | 4-(4-fluoro-2-methylanilino)-2,2-dimethylbutanenitrile |
| SMILES | Cc1cc(F)ccc1NCCC(C)(C)C#N |
| InChI | InChI=1S/C13H17FN2/c1-10-8-11(14)4-5-12(10)16-7-6-13(2,3)9-15/h4-5,8,16H,6-7H2,1-3H3 |
| InChIKey | UXZXIRCUOKJPPN-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |