C13H16BrFN2 — CID 65248662
4-[(2-bromo-5-fluorophenyl)methylamino]-2,2-dimethylbutanenitrile (PubChem CID 65248662) has the molecular formula C13H16BrFN2 and a molecular weight of 299.19 g/mol. Its IUPAC name is 4-[(2-bromo-5-fluorophenyl)methylamino]-2,2-dimethylbutanenitrile.
| Compound Name | 4-[(2-bromo-5-fluorophenyl)methylamino]-2,2-dimethylbutanenitrile |
|---|---|
| PubChem CID | 65248662 |
| Molecular Formula | C13H16BrFN2 |
| Molecular Weight | 299.19 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | 4-[(2-bromo-5-fluorophenyl)methylamino]-2,2-dimethylbutanenitrile |
| SMILES | CC(C)(C#N)CCNCc1cc(F)ccc1Br |
| InChI | InChI=1S/C13H16BrFN2/c1-13(2,9-16)5-6-17-8-10-7-11(15)3-4-12(10)14/h3-4,7,17H,5-6,8H2,1-2H3 |
| InChIKey | DOYAUASBGIMODJ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.19 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|