C12H17BrFNOS — CID 97102273
(3R)-N-[(2-bromo-5-fluorophenyl)methyl]-3-[(S)-methylsulfinyl]butan-1-amine (PubChem CID 97102273) has the molecular formula C12H17BrFNOS and a molecular weight of 322.24 g/mol. Its IUPAC name is (3R)-N-[(2-bromo-5-fluorophenyl)methyl]-3-[(S)-methylsulfinyl]butan-1-amine.
| Compound Name | (3R)-N-[(2-bromo-5-fluorophenyl)methyl]-3-[(S)-methylsulfinyl]butan-1-amine |
|---|---|
| PubChem CID | 97102273 |
| Molecular Formula | C12H17BrFNOS |
| Molecular Weight | 322.24 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | (3R)-N-[(2-bromo-5-fluorophenyl)methyl]-3-[(S)-methylsulfinyl]butan-1-amine |
| SMILES | C[C@H](CCNCc1cc(F)ccc1Br)[S@](C)=O |
| InChI | InChI=1S/C12H17BrFNOS/c1-9(17(2)16)5-6-15-8-10-7-11(14)3-4-12(10)13/h3-4,7,9,15H,5-6,8H2,1-2H3/t9-,17+/m1/s1 |
| InChIKey | KOOUQGKYZULLTJ-XLFHBGCDSA-N |
| XLogP | 2.83 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.24 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|