C15H20BrN3O — CID 75381830
N-[4-bromo-2-[(4-cyano-4-methylpentyl)amino]phenyl]acetamide (PubChem CID 75381830) has the molecular formula C15H20BrN3O and a molecular weight of 338.25 g/mol. Its IUPAC name is N-[4-bromo-2-[(4-cyano-4-methylpentyl)amino]phenyl]acetamide.
| Compound Name | N-[4-bromo-2-[(4-cyano-4-methylpentyl)amino]phenyl]acetamide |
|---|---|
| PubChem CID | 75381830 |
| Molecular Formula | C15H20BrN3O |
| Molecular Weight | 338.25 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | N-[4-bromo-2-[(4-cyano-4-methylpentyl)amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(Br)cc1NCCCC(C)(C)C#N |
| InChI | InChI=1S/C15H20BrN3O/c1-11(20)19-13-6-5-12(16)9-14(13)18-8-4-7-15(2,3)10-17/h5-6,9,18H,4,7-8H2,1-3H3,(H,19,20) |
| InChIKey | AWGROGQFBTUTMR-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.25 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|