C12H17N3O4S — CID 54606442
(2E)-2-ethoxyimino-N'-(4-methylphenyl)sulfonylpropanehydrazide (PubChem CID 54606442) has the molecular formula C12H17N3O4S and a molecular weight of 299.35 g/mol. Its IUPAC name is (2E)-2-ethoxyimino-N'-(4-methylphenyl)sulfonylpropanehydrazide.
| Compound Name | (2E)-2-ethoxyimino-N'-(4-methylphenyl)sulfonylpropanehydrazide |
|---|---|
| PubChem CID | 54606442 |
| Molecular Formula | C12H17N3O4S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | (2E)-2-ethoxyimino-N'-(4-methylphenyl)sulfonylpropanehydrazide |
| SMILES | CCO/N=C(\C)C(=O)NNS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C12H17N3O4S/c1-4-19-14-10(3)12(16)13-15-20(17,18)11-7-5-9(2)6-8-11/h5-8,15H,4H2,1-3H3,(H,13,16)/b14-10+ |
| InChIKey | IXMYUHDXDHOIDL-GXDHUFHOSA-N |
| XLogP | 0.72 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|