C15H15FN2O3S — CID 8504906
N'-(4-fluorophenyl)sulfonyl-2,4-dimethylbenzohydrazide (PubChem CID 8504906) has the molecular formula C15H15FN2O3S and a molecular weight of 322.36 g/mol. Its IUPAC name is N'-(4-fluorophenyl)sulfonyl-2,4-dimethylbenzohydrazide.
| Compound Name | N'-(4-fluorophenyl)sulfonyl-2,4-dimethylbenzohydrazide |
|---|---|
| PubChem CID | 8504906 |
| Molecular Formula | C15H15FN2O3S |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | N'-(4-fluorophenyl)sulfonyl-2,4-dimethylbenzohydrazide |
| SMILES | Cc1ccc(C(=O)NNS(=O)(=O)c2ccc(F)cc2)c(C)c1 |
| InChI | InChI=1S/C15H15FN2O3S/c1-10-3-8-14(11(2)9-10)15(19)17-18-22(20,21)13-6-4-12(16)5-7-13/h3-9,18H,1-2H3,(H,17,19) |
| InChIKey | BOOLWXYXLYLXKD-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|