C15H11ClFN3O3S — CID 26980122
N'-(3-chloro-4-fluorophenyl)sulfonyl-1H-indole-3-carbohydrazide (PubChem CID 26980122) has the molecular formula C15H11ClFN3O3S and a molecular weight of 367.79 g/mol. Its IUPAC name is N'-(3-chloro-4-fluorophenyl)sulfonyl-1H-indole-3-carbohydrazide.
| Compound Name | N'-(3-chloro-4-fluorophenyl)sulfonyl-1H-indole-3-carbohydrazide |
|---|---|
| PubChem CID | 26980122 |
| Molecular Formula | C15H11ClFN3O3S |
| Molecular Weight | 367.79 g/mol |
| Exact Mass | 367.02 |
| IUPAC Name | N'-(3-chloro-4-fluorophenyl)sulfonyl-1H-indole-3-carbohydrazide |
| SMILES | O=C(NNS(=O)(=O)c1ccc(F)c(Cl)c1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C15H11ClFN3O3S/c16-12-7-9(5-6-13(12)17)24(22,23)20-19-15(21)11-8-18-14-4-2-1-3-10(11)14/h1-8,18,20H,(H,19,21) |
| InChIKey | PBXJLIURABFDJQ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.79 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|