C16H12N4O3S — CID 26980172
N'-(4-cyanophenyl)sulfonyl-1H-indole-3-carbohydrazide (PubChem CID 26980172) has the molecular formula C16H12N4O3S and a molecular weight of 340.36 g/mol. Its IUPAC name is N'-(4-cyanophenyl)sulfonyl-1H-indole-3-carbohydrazide.
| Compound Name | N'-(4-cyanophenyl)sulfonyl-1H-indole-3-carbohydrazide |
|---|---|
| PubChem CID | 26980172 |
| Molecular Formula | C16H12N4O3S |
| Molecular Weight | 340.36 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | N'-(4-cyanophenyl)sulfonyl-1H-indole-3-carbohydrazide |
| SMILES | N#Cc1ccc(S(=O)(=O)NNC(=O)c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C16H12N4O3S/c17-9-11-5-7-12(8-6-11)24(22,23)20-19-16(21)14-10-18-15-4-2-1-3-13(14)15/h1-8,10,18,20H,(H,19,21) |
| InChIKey | LOWKTPIMKFUYJU-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 114.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.36 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|