C22H16ClFN4O4S — CID 24541328
2-chloro-N-(4-fluorophenyl)-5-[(1H-indole-3-carbonylamino)carbamoyl]benzenesulfonamide (PubChem CID 24541328) has the molecular formula C22H16ClFN4O4S and a molecular weight of 486.91 g/mol. Its IUPAC name is 2-chloro-N-(4-fluorophenyl)-5-[(1H-indole-3-carbonylamino)carbamoyl]benzenesulfonamide.
| Compound Name | 2-chloro-N-(4-fluorophenyl)-5-[(1H-indole-3-carbonylamino)carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 24541328 |
| Molecular Formula | C22H16ClFN4O4S |
| Molecular Weight | 486.91 g/mol |
| Exact Mass | 486.06 |
| IUPAC Name | 2-chloro-N-(4-fluorophenyl)-5-[(1H-indole-3-carbonylamino)carbamoyl]benzenesulfonamide |
| SMILES | O=C(NNC(=O)c1c[nH]c2ccccc12)c1ccc(Cl)c(S(=O)(=O)Nc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C22H16ClFN4O4S/c23-18-10-5-13(11-20(18)33(31,32)28-15-8-6-14(24)7-9-15)21(29)26-27-22(30)17-12-25-19-4-2-1-3-16(17)19/h1-12,25,28H,(H,26,29)(H,27,30) |
| InChIKey | IGOIGWZCNXIGNV-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 120.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.91 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|