C42H60N4O8 — CID 18518195
(2E,4E)-N-ethyl-N-[3-[4-[3-[ethyl-[(2E,4E)-5-(3,4,5-trimethoxyphenyl)penta-2,4-dienoyl]amino]propyl]piperazin-1-yl]propyl]-5-(3,4,5-trimethoxyphenyl)penta-2,4-dienamide (PubChem CID 18518195) has the molecular formula C42H60N4O8 and a molecular weight of 748.96 g/mol. Its IUPAC name is (2E,4E)-N-ethyl-N-[3-[4-[3-[ethyl-[(2E,4E)-5-(3,4,5-trimethoxyphenyl)penta-2,4-dienoyl]amino]propyl]piperazin-1-yl]propyl]-5-(3,4,5-trimethoxyphenyl)penta-2,4-dienamide.
| Compound Name | (2E,4E)-N-ethyl-N-[3-[4-[3-[ethyl-[(2E,4E)-5-(3,4,5-trimethoxyphenyl)penta-2,4-dienoyl]amino]propyl]piperazin-1-yl]propyl]-5-(3,4,5-trimethoxyphenyl)penta-2,4-dienamide |
|---|---|
| PubChem CID | 18518195 |
| Molecular Formula | C42H60N4O8 |
| Molecular Weight | 748.96 g/mol |
| Exact Mass | 748.44 |
| IUPAC Name | (2E,4E)-N-ethyl-N-[3-[4-[3-[ethyl-[(2E,4E)-5-(3,4,5-trimethoxyphenyl)penta-2,4-dienoyl]amino]propyl]piperazin-1-yl]propyl]-5-(3,4,5-trimethoxyphenyl)penta-2,4-dienamide |
| SMILES | CCN(CCCN1CCN(CCCN(CC)C(=O)/C=C/C=C/c2cc(OC)c(OC)c(OC)c2)CC1)C(=O)/C=C/C=C/c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C42H60N4O8/c1-9-45(39(47)19-13-11-17-33-29-35(49-3)41(53-7)36(30-33)50-4)23-15-21-43-25-27-44(28-26-43)22-16-24-46(10-2)40(48)20-14-12-18-34-31-37(51-5)42(54-8)38(32-34)52-6/h11-14,17-20,29-32H,9-10,15-16,21-28H2,1-8H3/b17-11+,18-12+,19-13+,20-14+ |
| InChIKey | FZCYMQBQXWVKDF-JHTXPFLLSA-N |
| XLogP | 5.67 |
| TPSA | 102.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.96 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|