C39H52N4O8 — CID 142647390
(2E,4E)-5-(3,4,5-trimethoxyphenyl)-1-[4-[1-[4-[(2E,4E)-5-(3,4,5-trimethoxyphenyl)penta-2,4-dienoyl]piperazin-1-yl]propyl]piperazin-1-yl]penta-2,4-dien-1-one (PubChem CID 142647390) has the molecular formula C39H52N4O8 and a molecular weight of 704.87 g/mol. Its IUPAC name is (2E,4E)-5-(3,4,5-trimethoxyphenyl)-1-[4-[1-[4-[(2E,4E)-5-(3,4,5-trimethoxyphenyl)penta-2,4-dienoyl]piperazin-1-yl]propyl]piperazin-1-yl]penta-2,4-dien-1-one.
| Compound Name | (2E,4E)-5-(3,4,5-trimethoxyphenyl)-1-[4-[1-[4-[(2E,4E)-5-(3,4,5-trimethoxyphenyl)penta-2,4-dienoyl]piperazin-1-yl]propyl]piperazin-1-yl]penta-2,4-dien-1-one |
|---|---|
| PubChem CID | 142647390 |
| Molecular Formula | C39H52N4O8 |
| Molecular Weight | 704.87 g/mol |
| Exact Mass | 704.38 |
| IUPAC Name | (2E,4E)-5-(3,4,5-trimethoxyphenyl)-1-[4-[1-[4-[(2E,4E)-5-(3,4,5-trimethoxyphenyl)penta-2,4-dienoyl]piperazin-1-yl]propyl]piperazin-1-yl]penta-2,4-dien-1-one |
| SMILES | CCC(N1CCN(C(=O)/C=C/C=C/c2cc(OC)c(OC)c(OC)c2)CC1)N1CCN(C(=O)/C=C/C=C/c2cc(OC)c(OC)c(OC)c2)CC1 |
| InChI | InChI=1S/C39H52N4O8/c1-8-35(40-17-21-42(22-18-40)36(44)15-11-9-13-29-25-31(46-2)38(50-6)32(26-29)47-3)41-19-23-43(24-20-41)37(45)16-12-10-14-30-27-33(48-4)39(51-7)34(28-30)49-5/h9-16,25-28,35H,8,17-24H2,1-7H3/b13-9+,14-10+,15-11+,16-12+ |
| InChIKey | ICTLGOMDSPDESF-KUWVSJDVSA-N |
| XLogP | 4.60 |
| TPSA | 102.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.87 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|