C25H39N3O5 — CID 13340436
N-hexyl-2-[4-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]piperazin-1-yl]propanamide (PubChem CID 13340436) has the molecular formula C25H39N3O5 and a molecular weight of 461.60 g/mol. Its IUPAC name is N-hexyl-2-[4-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]piperazin-1-yl]propanamide.
| Compound Name | N-hexyl-2-[4-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 13340436 |
| Molecular Formula | C25H39N3O5 |
| Molecular Weight | 461.60 g/mol |
| Exact Mass | 461.29 |
| IUPAC Name | N-hexyl-2-[4-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]piperazin-1-yl]propanamide |
| SMILES | CCCCCCNC(=O)C(C)N1CCN(C(=O)/C=C/c2cc(OC)c(OC)c(OC)c2)CC1 |
| InChI | InChI=1S/C25H39N3O5/c1-6-7-8-9-12-26-25(30)19(2)27-13-15-28(16-14-27)23(29)11-10-20-17-21(31-3)24(33-5)22(18-20)32-4/h10-11,17-19H,6-9,12-16H2,1-5H3,(H,26,30)/b11-10+ |
| InChIKey | ZHEPXIXXYYUJLV-ZHACJKMWSA-N |
| XLogP | 2.95 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.60 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|