C25H37N3O5 — CID 70505550
N-cyclohexyl-2-[4-[3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]piperazin-1-yl]propanamide (PubChem CID 70505550) has the molecular formula C25H37N3O5 and a molecular weight of 459.59 g/mol. Its IUPAC name is N-cyclohexyl-2-[4-[3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]piperazin-1-yl]propanamide.
| Compound Name | N-cyclohexyl-2-[4-[3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 70505550 |
| Molecular Formula | C25H37N3O5 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.27 |
| IUPAC Name | N-cyclohexyl-2-[4-[3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]piperazin-1-yl]propanamide |
| SMILES | COc1cc(C=CC(=O)N2CCN(C(C)C(=O)NC3CCCCC3)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C25H37N3O5/c1-18(25(30)26-20-8-6-5-7-9-20)27-12-14-28(15-13-27)23(29)11-10-19-16-21(31-2)24(33-4)22(17-19)32-3/h10-11,16-18,20H,5-9,12-15H2,1-4H3,(H,26,30) |
| InChIKey | KZKOEUAZZARFEQ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|