C18H25NO6S — CID 90585187
(E)-1-(4-methylsulfonylpiperidin-1-yl)-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one (PubChem CID 90585187) has the molecular formula C18H25NO6S and a molecular weight of 383.47 g/mol. Its IUPAC name is (E)-1-(4-methylsulfonylpiperidin-1-yl)-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(4-methylsulfonylpiperidin-1-yl)-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 90585187 |
| Molecular Formula | C18H25NO6S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | (E)-1-(4-methylsulfonylpiperidin-1-yl)-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cc(/C=C/C(=O)N2CCC(S(C)(=O)=O)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C18H25NO6S/c1-23-15-11-13(12-16(24-2)18(15)25-3)5-6-17(20)19-9-7-14(8-10-19)26(4,21)22/h5-6,11-12,14H,7-10H2,1-4H3/b6-5+ |
| InChIKey | WNNWVOIVNDGJLO-AATRIKPKSA-N |
| XLogP | 1.76 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|