C21H28N4O4 — CID 90506445
(E)-1-[4-(3,5-dimethyl-1H-pyrazol-4-yl)piperazin-1-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one (PubChem CID 90506445) has the molecular formula C21H28N4O4 and a molecular weight of 400.48 g/mol. Its IUPAC name is (E)-1-[4-(3,5-dimethyl-1H-pyrazol-4-yl)piperazin-1-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-(3,5-dimethyl-1H-pyrazol-4-yl)piperazin-1-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 90506445 |
| Molecular Formula | C21H28N4O4 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | (E)-1-[4-(3,5-dimethyl-1H-pyrazol-4-yl)piperazin-1-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cc(/C=C/C(=O)N2CCN(c3c(C)n[nH]c3C)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C21H28N4O4/c1-14-20(15(2)23-22-14)25-10-8-24(9-11-25)19(26)7-6-16-12-17(27-3)21(29-5)18(13-16)28-4/h6-7,12-13H,8-11H2,1-5H3,(H,22,23)/b7-6+ |
| InChIKey | CRRKHDYXDNDRIA-VOTSOKGWSA-N |
| XLogP | 2.41 |
| TPSA | 79.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|