C33H38N2O10 — CID 22609489
1,4-bis[(2E,4E)-5-(3,4,5-trimethoxyphenyl)penta-2,4-dienoyl]piperazine-2-carboxylic acid (PubChem CID 22609489) has the molecular formula C33H38N2O10 and a molecular weight of 622.67 g/mol. Its IUPAC name is 1,4-bis[(2E,4E)-5-(3,4,5-trimethoxyphenyl)penta-2,4-dienoyl]piperazine-2-carboxylic acid.
| Compound Name | 1,4-bis[(2E,4E)-5-(3,4,5-trimethoxyphenyl)penta-2,4-dienoyl]piperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 22609489 |
| Molecular Formula | C33H38N2O10 |
| Molecular Weight | 622.67 g/mol |
| Exact Mass | 622.25 |
| IUPAC Name | 1,4-bis[(2E,4E)-5-(3,4,5-trimethoxyphenyl)penta-2,4-dienoyl]piperazine-2-carboxylic acid |
| SMILES | COc1cc(/C=C/C=C/C(=O)N2CCN(C(=O)/C=C/C=C/c3cc(OC)c(OC)c(OC)c3)C(C(=O)O)C2)cc(OC)c1OC |
| InChI | InChI=1S/C33H38N2O10/c1-40-25-17-22(18-26(41-2)31(25)44-5)11-7-9-13-29(36)34-15-16-35(24(21-34)33(38)39)30(37)14-10-8-12-23-19-27(42-3)32(45-6)28(20-23)43-4/h7-14,17-20,24H,15-16,21H2,1-6H3,(H,38,39)/b11-7+,12-8+,13-9+,14-10+ |
| InChIKey | DEJCTYLULJMTBM-DQVHGGFXSA-N |
| XLogP | 3.70 |
| TPSA | 133.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.67 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|