C33H41N3O8 — CID 22609525
(2E,4E)-1-[3-(aminomethyl)-4-[(2E,4E)-5-(3,4,5-trimethoxyphenyl)penta-2,4-dienoyl]piperazin-1-yl]-5-(3,4,5-trimethoxyphenyl)penta-2,4-dien-1-one (PubChem CID 22609525) has the molecular formula C33H41N3O8 and a molecular weight of 607.70 g/mol. Its IUPAC name is (2E,4E)-1-[3-(aminomethyl)-4-[(2E,4E)-5-(3,4,5-trimethoxyphenyl)penta-2,4-dienoyl]piperazin-1-yl]-5-(3,4,5-trimethoxyphenyl)penta-2,4-dien-1-one.
| Compound Name | (2E,4E)-1-[3-(aminomethyl)-4-[(2E,4E)-5-(3,4,5-trimethoxyphenyl)penta-2,4-dienoyl]piperazin-1-yl]-5-(3,4,5-trimethoxyphenyl)penta-2,4-dien-1-one |
|---|---|
| PubChem CID | 22609525 |
| Molecular Formula | C33H41N3O8 |
| Molecular Weight | 607.70 g/mol |
| Exact Mass | 607.29 |
| IUPAC Name | (2E,4E)-1-[3-(aminomethyl)-4-[(2E,4E)-5-(3,4,5-trimethoxyphenyl)penta-2,4-dienoyl]piperazin-1-yl]-5-(3,4,5-trimethoxyphenyl)penta-2,4-dien-1-one |
| SMILES | COc1cc(/C=C/C=C/C(=O)N2CCN(C(=O)/C=C/C=C/c3cc(OC)c(OC)c(OC)c3)C(CN)C2)cc(OC)c1OC |
| InChI | InChI=1S/C33H41N3O8/c1-39-26-17-23(18-27(40-2)32(26)43-5)11-7-9-13-30(37)35-15-16-36(25(21-34)22-35)31(38)14-10-8-12-24-19-28(41-3)33(44-6)29(20-24)42-4/h7-14,17-20,25H,15-16,21-22,34H2,1-6H3/b11-7+,12-8+,13-9+,14-10+ |
| InChIKey | QYIHZNNTKZHFAR-DQVHGGFXSA-N |
| XLogP | 3.58 |
| TPSA | 122.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.70 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|