C33H42ClN3O6 — CID 22609498
(2E,4E)-5-(2,6-dimethoxyphenyl)-1-[4-[(2E,4E)-5-(2,6-dimethoxyphenyl)penta-2,4-dienoyl]-3-[(dimethylamino)methyl]piperazin-1-yl]penta-2,4-dien-1-one;hydrochloride (PubChem CID 22609498) has the molecular formula C33H42ClN3O6 and a molecular weight of 612.17 g/mol. Its IUPAC name is (2E,4E)-5-(2,6-dimethoxyphenyl)-1-[4-[(2E,4E)-5-(2,6-dimethoxyphenyl)penta-2,4-dienoyl]-3-[(dimethylamino)methyl]piperazin-1-yl]penta-2,4-dien-1-one;hydrochloride.
| Compound Name | (2E,4E)-5-(2,6-dimethoxyphenyl)-1-[4-[(2E,4E)-5-(2,6-dimethoxyphenyl)penta-2,4-dienoyl]-3-[(dimethylamino)methyl]piperazin-1-yl]penta-2,4-dien-1-one;hydrochloride |
|---|---|
| PubChem CID | 22609498 |
| Molecular Formula | C33H42ClN3O6 |
| Molecular Weight | 612.17 g/mol |
| Exact Mass | 611.28 |
| IUPAC Name | (2E,4E)-5-(2,6-dimethoxyphenyl)-1-[4-[(2E,4E)-5-(2,6-dimethoxyphenyl)penta-2,4-dienoyl]-3-[(dimethylamino)methyl]piperazin-1-yl]penta-2,4-dien-1-one;hydrochloride |
| SMILES | COc1cccc(OC)c1/C=C/C=C/C(=O)N1CCN(C(=O)/C=C/C=C/c2c(OC)cccc2OC)C(CN(C)C)C1.Cl |
| InChI | InChI=1S/C33H41N3O6.ClH/c1-34(2)23-25-24-35(32(37)19-9-7-13-26-28(39-3)15-11-16-29(26)40-4)21-22-36(25)33(38)20-10-8-14-27-30(41-5)17-12-18-31(27)42-6;/h7-20,25H,21-24H2,1-6H3;1H/b13-7+,14-8+,19-9+,20-10+; |
| InChIKey | WQLCPFZQYLLWPA-STZAMWBMSA-N |
| XLogP | 4.58 |
| TPSA | 80.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.17 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|