C33H40N2O8 — CID 15546354
(2E,4E)-5-(2,4,6-trimethoxyphenyl)-1-[4-[(2E,4E)-5-(2,4,6-trimethoxyphenyl)penta-2,4-dienoyl]-1,4-diazepan-1-yl]penta-2,4-dien-1-one (PubChem CID 15546354) has the molecular formula C33H40N2O8 and a molecular weight of 592.69 g/mol. Its IUPAC name is (2E,4E)-5-(2,4,6-trimethoxyphenyl)-1-[4-[(2E,4E)-5-(2,4,6-trimethoxyphenyl)penta-2,4-dienoyl]-1,4-diazepan-1-yl]penta-2,4-dien-1-one.
| Compound Name | (2E,4E)-5-(2,4,6-trimethoxyphenyl)-1-[4-[(2E,4E)-5-(2,4,6-trimethoxyphenyl)penta-2,4-dienoyl]-1,4-diazepan-1-yl]penta-2,4-dien-1-one |
|---|---|
| PubChem CID | 15546354 |
| Molecular Formula | C33H40N2O8 |
| Molecular Weight | 592.69 g/mol |
| Exact Mass | 592.28 |
| IUPAC Name | (2E,4E)-5-(2,4,6-trimethoxyphenyl)-1-[4-[(2E,4E)-5-(2,4,6-trimethoxyphenyl)penta-2,4-dienoyl]-1,4-diazepan-1-yl]penta-2,4-dien-1-one |
| SMILES | COc1cc(OC)c(/C=C/C=C/C(=O)N2CCCN(C(=O)/C=C/C=C/c3c(OC)cc(OC)cc3OC)CC2)c(OC)c1 |
| InChI | InChI=1S/C33H40N2O8/c1-38-24-20-28(40-3)26(29(21-24)41-4)12-7-9-14-32(36)34-16-11-17-35(19-18-34)33(37)15-10-8-13-27-30(42-5)22-25(39-2)23-31(27)43-6/h7-10,12-15,20-23H,11,16-19H2,1-6H3/b12-7+,13-8+,14-9+,15-10+ |
| InChIKey | IANKKRUWBTZQGH-HJAKVRDMSA-N |
| XLogP | 4.64 |
| TPSA | 96.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.69 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|