C30H30F2N2O3 — CID 54234424
1-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-5-(2,4-dimethoxyphenyl)penta-2,4-dien-1-one (PubChem CID 54234424) has the molecular formula C30H30F2N2O3 and a molecular weight of 504.58 g/mol. Its IUPAC name is 1-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-5-(2,4-dimethoxyphenyl)penta-2,4-dien-1-one.
| Compound Name | 1-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-5-(2,4-dimethoxyphenyl)penta-2,4-dien-1-one |
|---|---|
| PubChem CID | 54234424 |
| Molecular Formula | C30H30F2N2O3 |
| Molecular Weight | 504.58 g/mol |
| Exact Mass | 504.22 |
| IUPAC Name | 1-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-5-(2,4-dimethoxyphenyl)penta-2,4-dien-1-one |
| SMILES | COc1ccc(C=CC=CC(=O)N2CCN(C(c3ccc(F)cc3)c3ccc(F)cc3)CC2)c(OC)c1 |
| InChI | InChI=1S/C30H30F2N2O3/c1-36-27-16-11-22(28(21-27)37-2)5-3-4-6-29(35)33-17-19-34(20-18-33)30(23-7-12-25(31)13-8-23)24-9-14-26(32)15-10-24/h3-16,21,30H,17-20H2,1-2H3 |
| InChIKey | QLNSLJKZSXNGPT-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.58 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|