C29H31ClF2N2O4 — CID 67932513
1-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-3-(2,3,4-trimethoxyphenyl)prop-2-en-1-one;hydrochloride (PubChem CID 67932513) has the molecular formula C29H31ClF2N2O4 and a molecular weight of 545.03 g/mol. Its IUPAC name is 1-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-3-(2,3,4-trimethoxyphenyl)prop-2-en-1-one;hydrochloride.
| Compound Name | 1-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-3-(2,3,4-trimethoxyphenyl)prop-2-en-1-one;hydrochloride |
|---|---|
| PubChem CID | 67932513 |
| Molecular Formula | C29H31ClF2N2O4 |
| Molecular Weight | 545.03 g/mol |
| Exact Mass | 544.19 |
| IUPAC Name | 1-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-3-(2,3,4-trimethoxyphenyl)prop-2-en-1-one;hydrochloride |
| SMILES | COc1ccc(C=CC(=O)N2CCN(C(c3ccc(F)cc3)c3ccc(F)cc3)CC2)c(OC)c1OC.Cl |
| InChI | InChI=1S/C29H30F2N2O4.ClH/c1-35-25-14-8-22(28(36-2)29(25)37-3)9-15-26(34)32-16-18-33(19-17-32)27(20-4-10-23(30)11-5-20)21-6-12-24(31)13-7-21;/h4-15,27H,16-19H2,1-3H3;1H |
| InChIKey | YBCIUTWWLPREGH-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.03 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|