C18H21N5O5 — CID 4084792
6-[4-[3-(2,3-dimethoxyphenyl)prop-2-enoyl]piperazin-1-yl]-2H-1,2,4-triazine-3,5-dione (PubChem CID 4084792) has the molecular formula C18H21N5O5 and a molecular weight of 387.40 g/mol. Its IUPAC name is 6-[4-[3-(2,3-dimethoxyphenyl)prop-2-enoyl]piperazin-1-yl]-2H-1,2,4-triazine-3,5-dione.
| Compound Name | 6-[4-[3-(2,3-dimethoxyphenyl)prop-2-enoyl]piperazin-1-yl]-2H-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 4084792 |
| Molecular Formula | C18H21N5O5 |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 6-[4-[3-(2,3-dimethoxyphenyl)prop-2-enoyl]piperazin-1-yl]-2H-1,2,4-triazine-3,5-dione |
| SMILES | COc1cccc(C=CC(=O)N2CCN(c3n[nH]c(=O)[nH]c3=O)CC2)c1OC |
| InChI | InChI=1S/C18H21N5O5/c1-27-13-5-3-4-12(15(13)28-2)6-7-14(24)22-8-10-23(11-9-22)16-17(25)19-18(26)21-20-16/h3-7H,8-11H2,1-2H3,(H2,19,21,25,26) |
| InChIKey | FAHURSAJPOTCPF-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 120.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|