C21H29NO5 — CID 8515503
[2-[methyl-(4-methylcyclohexyl)amino]-2-oxoethyl] (E)-3-(2,4-dimethoxyphenyl)prop-2-enoate (PubChem CID 8515503) has the molecular formula C21H29NO5 and a molecular weight of 375.47 g/mol. Its IUPAC name is [2-[methyl-(4-methylcyclohexyl)amino]-2-oxoethyl] (E)-3-(2,4-dimethoxyphenyl)prop-2-enoate.
| Compound Name | [2-[methyl-(4-methylcyclohexyl)amino]-2-oxoethyl] (E)-3-(2,4-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8515503 |
| Molecular Formula | C21H29NO5 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | [2-[methyl-(4-methylcyclohexyl)amino]-2-oxoethyl] (E)-3-(2,4-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(/C=C/C(=O)OCC(=O)N(C)C2CCC(C)CC2)c(OC)c1 |
| InChI | InChI=1S/C21H29NO5/c1-15-5-9-17(10-6-15)22(2)20(23)14-27-21(24)12-8-16-7-11-18(25-3)13-19(16)26-4/h7-8,11-13,15,17H,5-6,9-10,14H2,1-4H3/b12-8+ |
| InChIKey | SCXBCYVVHQAJBU-XYOKQWHBSA-N |
| XLogP | 3.30 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|