C25H29N3O3 — CID 6306555
[2-[1-(1-adamantyl)ethylamino]-2-oxoethyl] (E)-3-quinoxalin-2-ylprop-2-enoate (PubChem CID 6306555) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is [2-[1-(1-adamantyl)ethylamino]-2-oxoethyl] (E)-3-quinoxalin-2-ylprop-2-enoate.
| Compound Name | [2-[1-(1-adamantyl)ethylamino]-2-oxoethyl] (E)-3-quinoxalin-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 6306555 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | [2-[1-(1-adamantyl)ethylamino]-2-oxoethyl] (E)-3-quinoxalin-2-ylprop-2-enoate |
| SMILES | CC(NC(=O)COC(=O)/C=C/c1cnc2ccccc2n1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C25H29N3O3/c1-16(25-11-17-8-18(12-25)10-19(9-17)13-25)27-23(29)15-31-24(30)7-6-20-14-26-21-4-2-3-5-22(21)28-20/h2-7,14,16-19H,8-13,15H2,1H3,(H,27,29)/b7-6+ |
| InChIKey | HSBZNCSXAXWMRE-VOTSOKGWSA-N |
| XLogP | 3.91 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|