C22H23N5O5 — CID 16544368
[2-[(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] (E)-3-quinoxalin-2-ylprop-2-enoate (PubChem CID 16544368) has the molecular formula C22H23N5O5 and a molecular weight of 437.46 g/mol. Its IUPAC name is [2-[(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] (E)-3-quinoxalin-2-ylprop-2-enoate.
| Compound Name | [2-[(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] (E)-3-quinoxalin-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 16544368 |
| Molecular Formula | C22H23N5O5 |
| Molecular Weight | 437.46 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | [2-[(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] (E)-3-quinoxalin-2-ylprop-2-enoate |
| SMILES | CC1CCC2(CC1)NC(=O)N(NC(=O)COC(=O)/C=C/c1cnc3ccccc3n1)C2=O |
| InChI | InChI=1S/C22H23N5O5/c1-14-8-10-22(11-9-14)20(30)27(21(31)25-22)26-18(28)13-32-19(29)7-6-15-12-23-16-4-2-3-5-17(16)24-15/h2-7,12,14H,8-11,13H2,1H3,(H,25,31)(H,26,28)/b7-6+ |
| InChIKey | IDMUKCWCKTYCJN-VOTSOKGWSA-N |
| XLogP | 1.72 |
| TPSA | 130.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.46 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|