C17H23N3O5 — CID 7779146
[2-[(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] (2E,4E)-hexa-2,4-dienoate (PubChem CID 7779146) has the molecular formula C17H23N3O5 and a molecular weight of 349.39 g/mol. Its IUPAC name is [2-[(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] (2E,4E)-hexa-2,4-dienoate.
| Compound Name | [2-[(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] (2E,4E)-hexa-2,4-dienoate |
|---|---|
| PubChem CID | 7779146 |
| Molecular Formula | C17H23N3O5 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | [2-[(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] (2E,4E)-hexa-2,4-dienoate |
| SMILES | C/C=C/C=C/C(=O)OCC(=O)NN1C(=O)NC2(CCC(C)CC2)C1=O |
| InChI | InChI=1S/C17H23N3O5/c1-3-4-5-6-14(22)25-11-13(21)19-20-15(23)17(18-16(20)24)9-7-12(2)8-10-17/h3-6,12H,7-11H2,1-2H3,(H,18,24)(H,19,21)/b4-3+,6-5+ |
| InChIKey | ZSVJOHLIQFBEHG-VNKDHWASSA-N |
| XLogP | 1.19 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|