C26H20N6O4 — CID 166181883
2-(2-oxoquinoxalin-1-yl)-N-[4-[[2-(2-oxoquinoxalin-1-yl)acetyl]amino]phenyl]acetamide (PubChem CID 166181883) has the molecular formula C26H20N6O4 and a molecular weight of 480.48 g/mol. Its IUPAC name is 2-(2-oxoquinoxalin-1-yl)-N-[4-[[2-(2-oxoquinoxalin-1-yl)acetyl]amino]phenyl]acetamide.
| Compound Name | 2-(2-oxoquinoxalin-1-yl)-N-[4-[[2-(2-oxoquinoxalin-1-yl)acetyl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 166181883 |
| Molecular Formula | C26H20N6O4 |
| Molecular Weight | 480.48 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | 2-(2-oxoquinoxalin-1-yl)-N-[4-[[2-(2-oxoquinoxalin-1-yl)acetyl]amino]phenyl]acetamide |
| SMILES | O=C(Cn1c(=O)cnc2ccccc21)Nc1ccc(NC(=O)Cn2c(=O)cnc3ccccc32)cc1 |
| InChI | InChI=1S/C26H20N6O4/c33-23(15-31-21-7-3-1-5-19(21)27-13-25(31)35)29-17-9-11-18(12-10-17)30-24(34)16-32-22-8-4-2-6-20(22)28-14-26(32)36/h1-14H,15-16H2,(H,29,33)(H,30,34) |
| InChIKey | OTFQELFVGDBHMZ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 127.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.48 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |