C18H15N3O4 — CID 26098218
methyl 4-[[2-(2-oxoquinoxalin-1-yl)acetyl]amino]benzoate (PubChem CID 26098218) has the molecular formula C18H15N3O4 and a molecular weight of 337.34 g/mol. Its IUPAC name is methyl 4-[[2-(2-oxoquinoxalin-1-yl)acetyl]amino]benzoate.
| Compound Name | methyl 4-[[2-(2-oxoquinoxalin-1-yl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 26098218 |
| Molecular Formula | C18H15N3O4 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | methyl 4-[[2-(2-oxoquinoxalin-1-yl)acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)Cn2c(=O)cnc3ccccc32)cc1 |
| InChI | InChI=1S/C18H15N3O4/c1-25-18(24)12-6-8-13(9-7-12)20-16(22)11-21-15-5-3-2-4-14(15)19-10-17(21)23/h2-10H,11H2,1H3,(H,20,22) |
| InChIKey | WCOJSGQRZKTTGK-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |