C24H25F3N2O5 — CID 16549692
N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]-2-(3-methylbutyl)-1,3-dioxoisoindole-5-carboxamide (PubChem CID 16549692) has the molecular formula C24H25F3N2O5 and a molecular weight of 478.47 g/mol. Its IUPAC name is N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]-2-(3-methylbutyl)-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]-2-(3-methylbutyl)-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 16549692 |
| Molecular Formula | C24H25F3N2O5 |
| Molecular Weight | 478.47 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]-2-(3-methylbutyl)-1,3-dioxoisoindole-5-carboxamide |
| SMILES | COCCOc1ccc(C(F)(F)F)cc1NC(=O)c1ccc2c(c1)C(=O)N(CCC(C)C)C2=O |
| InChI | InChI=1S/C24H25F3N2O5/c1-14(2)8-9-29-22(31)17-6-4-15(12-18(17)23(29)32)21(30)28-19-13-16(24(25,26)27)5-7-20(19)34-11-10-33-3/h4-7,12-14H,8-11H2,1-3H3,(H,28,30) |
| InChIKey | YBUOHHSXKFOIMG-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.47 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|