C22H18F3N5O4 — CID 31527602
2-(3-methoxypropyl)-1,3-dioxo-N-[2-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)phenyl]isoindole-5-carboxamide (PubChem CID 31527602) has the molecular formula C22H18F3N5O4 and a molecular weight of 473.41 g/mol. Its IUPAC name is 2-(3-methoxypropyl)-1,3-dioxo-N-[2-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)phenyl]isoindole-5-carboxamide.
| Compound Name | 2-(3-methoxypropyl)-1,3-dioxo-N-[2-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)phenyl]isoindole-5-carboxamide |
|---|---|
| PubChem CID | 31527602 |
| Molecular Formula | C22H18F3N5O4 |
| Molecular Weight | 473.41 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | 2-(3-methoxypropyl)-1,3-dioxo-N-[2-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)phenyl]isoindole-5-carboxamide |
| SMILES | COCCCN1C(=O)c2ccc(C(=O)Nc3cc(C(F)(F)F)ccc3-n3cncn3)cc2C1=O |
| InChI | InChI=1S/C22H18F3N5O4/c1-34-8-2-7-29-20(32)15-5-3-13(9-16(15)21(29)33)19(31)28-17-10-14(22(23,24)25)4-6-18(17)30-12-26-11-27-30/h3-6,9-12H,2,7-8H2,1H3,(H,28,31) |
| InChIKey | DCFYSQWCUWSWHL-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.41 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|