C21H16F3N5O3 — CID 30442229
3-(5-methyl-1,3-dioxoisoindol-2-yl)-N-[2-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)phenyl]propanamide (PubChem CID 30442229) has the molecular formula C21H16F3N5O3 and a molecular weight of 443.39 g/mol. Its IUPAC name is 3-(5-methyl-1,3-dioxoisoindol-2-yl)-N-[2-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 3-(5-methyl-1,3-dioxoisoindol-2-yl)-N-[2-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 30442229 |
| Molecular Formula | C21H16F3N5O3 |
| Molecular Weight | 443.39 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | 3-(5-methyl-1,3-dioxoisoindol-2-yl)-N-[2-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)phenyl]propanamide |
| SMILES | Cc1ccc2c(c1)C(=O)N(CCC(=O)Nc1cc(C(F)(F)F)ccc1-n1cncn1)C2=O |
| InChI | InChI=1S/C21H16F3N5O3/c1-12-2-4-14-15(8-12)20(32)28(19(14)31)7-6-18(30)27-16-9-13(21(22,23)24)3-5-17(16)29-11-25-10-26-29/h2-5,8-11H,6-7H2,1H3,(H,27,30) |
| InChIKey | IJTWRCSGFGTYJK-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.39 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|