C19H14ClN5O3 — CID 8794641
N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-3-(1,3-dioxoisoindol-2-yl)propanamide (PubChem CID 8794641) has the molecular formula C19H14ClN5O3 and a molecular weight of 395.81 g/mol. Its IUPAC name is N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-3-(1,3-dioxoisoindol-2-yl)propanamide.
| Compound Name | N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-3-(1,3-dioxoisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 8794641 |
| Molecular Formula | C19H14ClN5O3 |
| Molecular Weight | 395.81 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-3-(1,3-dioxoisoindol-2-yl)propanamide |
| SMILES | O=C(CCN1C(=O)c2ccccc2C1=O)Nc1cc(Cl)ccc1-n1cncn1 |
| InChI | InChI=1S/C19H14ClN5O3/c20-12-5-6-16(25-11-21-10-22-25)15(9-12)23-17(26)7-8-24-18(27)13-3-1-2-4-14(13)19(24)28/h1-6,9-11H,7-8H2,(H,23,26) |
| InChIKey | FDDKAXQDHWXABL-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.81 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|