C21H18BrN5O3 — CID 60608856
N-[5-bromo-2-(1,2,4-triazol-1-yl)phenyl]-2-butyl-1,3-dioxoisoindole-5-carboxamide (PubChem CID 60608856) has the molecular formula C21H18BrN5O3 and a molecular weight of 468.31 g/mol. Its IUPAC name is N-[5-bromo-2-(1,2,4-triazol-1-yl)phenyl]-2-butyl-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | N-[5-bromo-2-(1,2,4-triazol-1-yl)phenyl]-2-butyl-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 60608856 |
| Molecular Formula | C21H18BrN5O3 |
| Molecular Weight | 468.31 g/mol |
| Exact Mass | 467.06 |
| IUPAC Name | N-[5-bromo-2-(1,2,4-triazol-1-yl)phenyl]-2-butyl-1,3-dioxoisoindole-5-carboxamide |
| SMILES | CCCCN1C(=O)c2ccc(C(=O)Nc3cc(Br)ccc3-n3cncn3)cc2C1=O |
| InChI | InChI=1S/C21H18BrN5O3/c1-2-3-8-26-20(29)15-6-4-13(9-16(15)21(26)30)19(28)25-17-10-14(22)5-7-18(17)27-12-23-11-24-27/h4-7,9-12H,2-3,8H2,1H3,(H,25,28) |
| InChIKey | JVJGQAVBAGIJRU-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.31 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|