C13H15BrN4O — CID 94413580
(2S)-N-[5-bromo-2-(1,2,4-triazol-1-yl)phenyl]-2-methylbutanamide (PubChem CID 94413580) has the molecular formula C13H15BrN4O and a molecular weight of 323.19 g/mol. Its IUPAC name is (2S)-N-[5-bromo-2-(1,2,4-triazol-1-yl)phenyl]-2-methylbutanamide.
| Compound Name | (2S)-N-[5-bromo-2-(1,2,4-triazol-1-yl)phenyl]-2-methylbutanamide |
|---|---|
| PubChem CID | 94413580 |
| Molecular Formula | C13H15BrN4O |
| Molecular Weight | 323.19 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | (2S)-N-[5-bromo-2-(1,2,4-triazol-1-yl)phenyl]-2-methylbutanamide |
| SMILES | CC[C@H](C)C(=O)Nc1cc(Br)ccc1-n1cncn1 |
| InChI | InChI=1S/C13H15BrN4O/c1-3-9(2)13(19)17-11-6-10(14)4-5-12(11)18-8-15-7-16-18/h4-9H,3H2,1-2H3,(H,17,19)/t9-/m0/s1 |
| InChIKey | MFNWAHLDABHBPP-VIFPVBQESA-N |
| XLogP | 3.01 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.19 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |