C20H16BrN2O5- — CID 2215982
5-bromo-2-[(2-butyl-1,3-dioxoisoindole-5-carbonyl)amino]benzoate (PubChem CID 2215982) has the molecular formula C20H16BrN2O5- and a molecular weight of 444.26 g/mol. Its IUPAC name is 5-bromo-2-[(2-butyl-1,3-dioxoisoindole-5-carbonyl)amino]benzoate.
| Compound Name | 5-bromo-2-[(2-butyl-1,3-dioxoisoindole-5-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 2215982 |
| Molecular Formula | C20H16BrN2O5- |
| Molecular Weight | 444.26 g/mol |
| Exact Mass | 443.02 |
| IUPAC Name | 5-bromo-2-[(2-butyl-1,3-dioxoisoindole-5-carbonyl)amino]benzoate |
| SMILES | CCCCN1C(=O)c2ccc(C(=O)Nc3ccc(Br)cc3C(=O)[O-])cc2C1=O |
| InChI | InChI=1S/C20H17BrN2O5/c1-2-3-8-23-18(25)13-6-4-11(9-14(13)19(23)26)17(24)22-16-7-5-12(21)10-15(16)20(27)28/h4-7,9-10H,2-3,8H2,1H3,(H,22,24)(H,27,28)/p-1 |
| InChIKey | QOVHQTHJRRXDOZ-UHFFFAOYSA-M |
| XLogP | 2.46 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.26 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|