C22H22F3N3O4 — CID 55642775
N-[4-(dimethylamino)-2-(trifluoromethyl)phenyl]-2-(3-methoxypropyl)-1,3-dioxoisoindole-5-carboxamide (PubChem CID 55642775) has the molecular formula C22H22F3N3O4 and a molecular weight of 449.43 g/mol. Its IUPAC name is N-[4-(dimethylamino)-2-(trifluoromethyl)phenyl]-2-(3-methoxypropyl)-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | N-[4-(dimethylamino)-2-(trifluoromethyl)phenyl]-2-(3-methoxypropyl)-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 55642775 |
| Molecular Formula | C22H22F3N3O4 |
| Molecular Weight | 449.43 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | N-[4-(dimethylamino)-2-(trifluoromethyl)phenyl]-2-(3-methoxypropyl)-1,3-dioxoisoindole-5-carboxamide |
| SMILES | COCCCN1C(=O)c2ccc(C(=O)Nc3ccc(N(C)C)cc3C(F)(F)F)cc2C1=O |
| InChI | InChI=1S/C22H22F3N3O4/c1-27(2)14-6-8-18(17(12-14)22(23,24)25)26-19(29)13-5-7-15-16(11-13)21(31)28(20(15)30)9-4-10-32-3/h5-8,11-12H,4,9-10H2,1-3H3,(H,26,29) |
| InChIKey | YSTUSPUHXQGVEU-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.43 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|