C21H25N3O3 — CID 41269421
3-[[2-(3,4-dimethylphenoxy)acetyl]amino]-4-pyrrolidin-1-ylbenzamide (PubChem CID 41269421) has the molecular formula C21H25N3O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is 3-[[2-(3,4-dimethylphenoxy)acetyl]amino]-4-pyrrolidin-1-ylbenzamide.
| Compound Name | 3-[[2-(3,4-dimethylphenoxy)acetyl]amino]-4-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 41269421 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 3-[[2-(3,4-dimethylphenoxy)acetyl]amino]-4-pyrrolidin-1-ylbenzamide |
| SMILES | Cc1ccc(OCC(=O)Nc2cc(C(N)=O)ccc2N2CCCC2)cc1C |
| InChI | InChI=1S/C21H25N3O3/c1-14-5-7-17(11-15(14)2)27-13-20(25)23-18-12-16(21(22)26)6-8-19(18)24-9-3-4-10-24/h5-8,11-12H,3-4,9-10,13H2,1-2H3,(H2,22,26)(H,23,25) |
| InChIKey | JCRMAXWFDHNIQF-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |