C20H22IN3O3 — CID 55553639
3-[[2-(4-iodophenoxy)acetyl]amino]-4-piperidin-1-ylbenzamide (PubChem CID 55553639) has the molecular formula C20H22IN3O3 and a molecular weight of 479.32 g/mol. Its IUPAC name is 3-[[2-(4-iodophenoxy)acetyl]amino]-4-piperidin-1-ylbenzamide.
| Compound Name | 3-[[2-(4-iodophenoxy)acetyl]amino]-4-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 55553639 |
| Molecular Formula | C20H22IN3O3 |
| Molecular Weight | 479.32 g/mol |
| Exact Mass | 479.07 |
| IUPAC Name | 3-[[2-(4-iodophenoxy)acetyl]amino]-4-piperidin-1-ylbenzamide |
| SMILES | NC(=O)c1ccc(N2CCCCC2)c(NC(=O)COc2ccc(I)cc2)c1 |
| InChI | InChI=1S/C20H22IN3O3/c21-15-5-7-16(8-6-15)27-13-19(25)23-17-12-14(20(22)26)4-9-18(17)24-10-2-1-3-11-24/h4-9,12H,1-3,10-11,13H2,(H2,22,26)(H,23,25) |
| InChIKey | ZHMRFFQKHRKHNY-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.32 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|