C17H21ClN4O3S — CID 27860722
N-(2-chlorophenyl)-2-[4-[2-(2-oxo-1,3-thiazolidin-3-yl)acetyl]piperazin-1-yl]acetamide (PubChem CID 27860722) has the molecular formula C17H21ClN4O3S and a molecular weight of 396.90 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-[4-[2-(2-oxo-1,3-thiazolidin-3-yl)acetyl]piperazin-1-yl]acetamide.
| Compound Name | N-(2-chlorophenyl)-2-[4-[2-(2-oxo-1,3-thiazolidin-3-yl)acetyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 27860722 |
| Molecular Formula | C17H21ClN4O3S |
| Molecular Weight | 396.90 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | N-(2-chlorophenyl)-2-[4-[2-(2-oxo-1,3-thiazolidin-3-yl)acetyl]piperazin-1-yl]acetamide |
| SMILES | O=C(CN1CCN(C(=O)CN2CCSC2=O)CC1)Nc1ccccc1Cl |
| InChI | InChI=1S/C17H21ClN4O3S/c18-13-3-1-2-4-14(13)19-15(23)11-20-5-7-21(8-6-20)16(24)12-22-9-10-26-17(22)25/h1-4H,5-12H2,(H,19,23) |
| InChIKey | ZMYKGPXTZNSSBP-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.90 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|